About [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate
[2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate (PubChem CID 2470959) has the molecular formula C21H14F4O2
and a molecular weight of 374.33 g/mol. Its IUPAC name is [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate.
Molecular Properties
| Compound Name | [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate |
| PubChem CID | 2470959 |
| Molecular Formula | C21H14F4O2 |
| Molecular Weight | 374.33 g/mol |
| Exact Mass | 374.09 |
| IUPAC Name | [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate |
| SMILES | Cc1ccc(-c2ccc(OC(=O)c3cc(F)c(F)c(F)c3F)c(C)c2)cc1 |
| InChI | InChI=1S/C21H14F4O2/c1-11-3-5-13(6-4-11)14-7-8-17(12(2)9-14)27-21(26)15-10-16(22)19(24)20(25)18(15)23/h3-10H,1-2H3 |
| InChIKey | LRVBFCWIVFIFML-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 374.33 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate?
The IUPAC name of [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate (CID 2470959) is [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate.
What is the SMILES notation for [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate?
The canonical SMILES for [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate is Cc1ccc(-c2ccc(OC(=O)c3cc(F)c(F)c(F)c3F)c(C)c2)cc1.
What is the InChIKey of [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate?
The InChIKey is LRVBFCWIVFIFML-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H14F4O2/c1-11-3-5-13(6-4-11)14-7-8-17(12(2)9-14)27-21(26)15-10-16(22)19(24)20(25)18(15)23/h3-10H,1-2H3.
What are the key properties of [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate?
[2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate has a molecular weight of 374.33 g/mol, XLogP of 5.75, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [2-methyl-4-(4-methylphenyl)phenyl] 2,3,4,5-tetrafluorobenzoate is sourced from PubChem (CID 2470959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).