About 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one
5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one (PubChem CID 24709706) has the molecular formula C10H11BrN2O
and a molecular weight of 255.11 g/mol. Its IUPAC name is 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one.
Molecular Properties
| Compound Name | 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one |
| PubChem CID | 24709706 |
| Molecular Formula | C10H11BrN2O |
| Molecular Weight | 255.11 g/mol |
| Exact Mass | 254.01 |
| IUPAC Name | 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one |
| SMILES | CCNC1C(=O)Nc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H11BrN2O/c1-2-12-9-7-5-6(11)3-4-8(7)13-10(9)14/h3-5,9,12H,2H2,1H3,(H,13,14) |
| InChIKey | AZWXLRCDZSJXSP-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.11 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one?
The IUPAC name of 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one (CID 24709706) is 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one.
What is the SMILES notation for 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one?
The canonical SMILES for 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one is CCNC1C(=O)Nc2ccc(Br)cc21.
What is the InChIKey of 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one?
The InChIKey is AZWXLRCDZSJXSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2O/c1-2-12-9-7-5-6(11)3-4-8(7)13-10(9)14/h3-5,9,12H,2H2,1H3,(H,13,14).
What are the key properties of 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one?
5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one has a molecular weight of 255.11 g/mol, XLogP of 2.05, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-3-(ethylamino)-1,3-dihydroindol-2-one is sourced from PubChem (CID 24709706), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).