About 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid
5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid (PubChem CID 24710087) has the molecular formula C10H12N4O6
and a molecular weight of 284.23 g/mol. Its IUPAC name is 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid.
Molecular Properties
| Compound Name | 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid |
| PubChem CID | 24710087 |
| Molecular Formula | C10H12N4O6 |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NC(=O)c1cc(=O)[nH]c(=O)[nH]1)C(=O)O |
| InChI | InChI=1S/C10H12N4O6/c11-6(15)2-1-4(9(18)19)12-8(17)5-3-7(16)14-10(20)13-5/h3-4H,1-2H2,(H2,11,15)(H,12,17)(H,18,19)(H2,13,14,16,20) |
| InChIKey | QBGKVMLESVNLCE-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 175.21 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid?
The IUPAC name of 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid (CID 24710087) is 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid.
What is the SMILES notation for 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid?
The canonical SMILES for 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid is NC(=O)CCC(NC(=O)c1cc(=O)[nH]c(=O)[nH]1)C(=O)O.
What is the InChIKey of 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid?
The InChIKey is QBGKVMLESVNLCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N4O6/c11-6(15)2-1-4(9(18)19)12-8(17)5-3-7(16)14-10(20)13-5/h3-4H,1-2H2,(H2,11,15)(H,12,17)(H,18,19)(H2,13,14,16,20).
What are the key properties of 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid?
5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid has a molecular weight of 284.23 g/mol, XLogP of -2.49, 6 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2-[(2,4-dioxo-1H-pyrimidine-6-carbonyl)amino]-5-oxopentanoic acid is sourced from PubChem (CID 24710087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).