About 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide
2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide (PubChem CID 24710997) has the molecular formula C15H14N4O2
and a molecular weight of 282.30 g/mol. Its IUPAC name is 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide.
Molecular Properties
| Compound Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide |
| PubChem CID | 24710997 |
| Molecular Formula | C15H14N4O2 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccnc(Oc2ccc3c(c2)CCC(=O)N3)c1 |
| InChI | InChI=1S/C15H14N4O2/c16-15(17)10-5-6-18-14(8-10)21-11-2-3-12-9(7-11)1-4-13(20)19-12/h2-3,5-8H,1,4H2,(H3,16,17)(H,19,20) |
| InChIKey | RTTMWABRMKESLE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 101.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide?
The IUPAC name of 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide (CID 24710997) is 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide.
What is the SMILES notation for 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide?
The canonical SMILES for 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide is [H]/N=C(\N)c1ccnc(Oc2ccc3c(c2)CCC(=O)N3)c1.
What is the InChIKey of 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide?
The InChIKey is RTTMWABRMKESLE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N4O2/c16-15(17)10-5-6-18-14(8-10)21-11-2-3-12-9(7-11)1-4-13(20)19-12/h2-3,5-8H,1,4H2,(H3,16,17)(H,19,20).
What are the key properties of 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide?
2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide has a molecular weight of 282.30 g/mol, XLogP of 2.04, 3 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2-oxo-3,4-dihydro-1H-quinolin-6-yl)oxy]pyridine-4-carboximidamide is sourced from PubChem (CID 24710997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).