C13H15N3O4 — CID 24711422
5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-1-methylpyrazole-4-carboxylic acid (PubChem CID 24711422) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-1-methylpyrazole-4-carboxylic acid.
| Compound Name | 5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-1-methylpyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 24711422 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 5-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-1-methylpyrazole-4-carboxylic acid |
| SMILES | Cn1ncc(C(=O)O)c1N1C(=O)C2CCCCC2C1=O |
| InChI | InChI=1S/C13H15N3O4/c1-15-10(9(6-14-15)13(19)20)16-11(17)7-4-2-3-5-8(7)12(16)18/h6-8H,2-5H2,1H3,(H,19,20) |
| InChIKey | RQHNXKPKRVYWHN-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|