About 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one
2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one (PubChem CID 24711694) has the molecular formula C11H22N2O4S
and a molecular weight of 278.37 g/mol. Its IUPAC name is 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one.
Molecular Properties
| Compound Name | 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one |
| PubChem CID | 24711694 |
| Molecular Formula | C11H22N2O4S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one |
| SMILES | CC1CN(C(=O)C(N)CCS(C)(=O)=O)CC(C)O1 |
| InChI | InChI=1S/C11H22N2O4S/c1-8-6-13(7-9(2)17-8)11(14)10(12)4-5-18(3,15)16/h8-10H,4-7,12H2,1-3H3 |
| InChIKey | CCZCFGOKNMYXIK-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one?
The IUPAC name of 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one (CID 24711694) is 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one.
What is the SMILES notation for 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one?
The canonical SMILES for 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one is CC1CN(C(=O)C(N)CCS(C)(=O)=O)CC(C)O1.
What is the InChIKey of 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one?
The InChIKey is CCZCFGOKNMYXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22N2O4S/c1-8-6-13(7-9(2)17-8)11(14)10(12)4-5-18(3,15)16/h8-10H,4-7,12H2,1-3H3.
What are the key properties of 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one?
2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one has a molecular weight of 278.37 g/mol, XLogP of -0.62, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-1-(2,6-dimethylmorpholin-4-yl)-4-methylsulfonylbutan-1-one is sourced from PubChem (CID 24711694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).