C12H16N2O3S2 — CID 24712221
N-(2-methoxyethyl)-2-(4-oxo-2-thiophen-3-yl-1,3-thiazolidin-3-yl)acetamide (PubChem CID 24712221) has the molecular formula C12H16N2O3S2 and a molecular weight of 300.41 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(4-oxo-2-thiophen-3-yl-1,3-thiazolidin-3-yl)acetamide.
| Compound Name | N-(2-methoxyethyl)-2-(4-oxo-2-thiophen-3-yl-1,3-thiazolidin-3-yl)acetamide |
|---|---|
| PubChem CID | 24712221 |
| Molecular Formula | C12H16N2O3S2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | N-(2-methoxyethyl)-2-(4-oxo-2-thiophen-3-yl-1,3-thiazolidin-3-yl)acetamide |
| SMILES | COCCNC(=O)CN1C(=O)CSC1c1ccsc1 |
| InChI | InChI=1S/C12H16N2O3S2/c1-17-4-3-13-10(15)6-14-11(16)8-19-12(14)9-2-5-18-7-9/h2,5,7,12H,3-4,6,8H2,1H3,(H,13,15) |
| InChIKey | GGBRVUPHWKSCMP-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|