C18H26N4O — CID 24712336
1-ethyl-1-[[1-[(2-methylphenyl)methyl]imidazol-2-yl]methyl]-3-propylurea (PubChem CID 24712336) has the molecular formula C18H26N4O and a molecular weight of 314.43 g/mol. Its IUPAC name is 1-ethyl-1-[[1-[(2-methylphenyl)methyl]imidazol-2-yl]methyl]-3-propylurea.
| Compound Name | 1-ethyl-1-[[1-[(2-methylphenyl)methyl]imidazol-2-yl]methyl]-3-propylurea |
|---|---|
| PubChem CID | 24712336 |
| Molecular Formula | C18H26N4O |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.21 |
| IUPAC Name | 1-ethyl-1-[[1-[(2-methylphenyl)methyl]imidazol-2-yl]methyl]-3-propylurea |
| SMILES | CCCNC(=O)N(CC)Cc1nccn1Cc1ccccc1C |
| InChI | InChI=1S/C18H26N4O/c1-4-10-20-18(23)21(5-2)14-17-19-11-12-22(17)13-16-9-7-6-8-15(16)3/h6-9,11-12H,4-5,10,13-14H2,1-3H3,(H,20,23) |
| InChIKey | GNOVGVXDCIKMDN-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |