C17H22N4O4 — CID 24712676
N-(2-methoxyethyl)-2-(3-methylphenyl)-3,5-dioxo-4-propyl-1,2,4-triazine-6-carboxamide (PubChem CID 24712676) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is N-(2-methoxyethyl)-2-(3-methylphenyl)-3,5-dioxo-4-propyl-1,2,4-triazine-6-carboxamide.
| Compound Name | N-(2-methoxyethyl)-2-(3-methylphenyl)-3,5-dioxo-4-propyl-1,2,4-triazine-6-carboxamide |
|---|---|
| PubChem CID | 24712676 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-(2-methoxyethyl)-2-(3-methylphenyl)-3,5-dioxo-4-propyl-1,2,4-triazine-6-carboxamide |
| SMILES | CCCn1c(=O)c(C(=O)NCCOC)nn(-c2cccc(C)c2)c1=O |
| InChI | InChI=1S/C17H22N4O4/c1-4-9-20-16(23)14(15(22)18-8-10-25-3)19-21(17(20)24)13-7-5-6-12(2)11-13/h5-7,11H,4,8-10H2,1-3H3,(H,18,22) |
| InChIKey | HQYHMRHPCLUHNA-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|