About 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol
1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol (PubChem CID 24713480) has the molecular formula C17H25F2NO2
and a molecular weight of 313.39 g/mol. Its IUPAC name is 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol.
Molecular Properties
| Compound Name | 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol |
| PubChem CID | 24713480 |
| Molecular Formula | C17H25F2NO2 |
| Molecular Weight | 313.39 g/mol |
| Exact Mass | 313.19 |
| IUPAC Name | 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol |
| SMILES | C=CCCC(O)CN(CCCOC)Cc1ccc(F)cc1F |
| InChI | InChI=1S/C17H25F2NO2/c1-3-4-6-16(21)13-20(9-5-10-22-2)12-14-7-8-15(18)11-17(14)19/h3,7-8,11,16,21H,1,4-6,9-10,12-13H2,2H3 |
| InChIKey | UACOBKLYZITDAB-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol?
The IUPAC name of 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol (CID 24713480) is 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol.
What is the SMILES notation for 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol?
The canonical SMILES for 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol is C=CCCC(O)CN(CCCOC)Cc1ccc(F)cc1F.
What is the InChIKey of 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol?
The InChIKey is UACOBKLYZITDAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H25F2NO2/c1-3-4-6-16(21)13-20(9-5-10-22-2)12-14-7-8-15(18)11-17(14)19/h3,7-8,11,16,21H,1,4-6,9-10,12-13H2,2H3.
What are the key properties of 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol?
1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol has a molecular weight of 313.39 g/mol, XLogP of 3.13, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4-difluorophenyl)methyl-(3-methoxypropyl)amino]hex-5-en-2-ol is sourced from PubChem (CID 24713480), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).