About 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one
1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one (PubChem CID 24714513) has the molecular formula C12H13FN2OS
and a molecular weight of 252.31 g/mol. Its IUPAC name is 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one |
| PubChem CID | 24714513 |
| Molecular Formula | C12H13FN2OS |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.07 |
| IUPAC Name | 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one |
| SMILES | CCN1C(=O)C2(NCCS2)c2cc(F)ccc21 |
| InChI | InChI=1S/C12H13FN2OS/c1-2-15-10-4-3-8(13)7-9(10)12(11(15)16)14-5-6-17-12/h3-4,7,14H,2,5-6H2,1H3 |
| InChIKey | ITJPUKUSTZKJRV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one?
The IUPAC name of 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one (CID 24714513) is 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one.
What is the SMILES notation for 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one?
The canonical SMILES for 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one is CCN1C(=O)C2(NCCS2)c2cc(F)ccc21.
What is the InChIKey of 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one?
The InChIKey is ITJPUKUSTZKJRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13FN2OS/c1-2-15-10-4-3-8(13)7-9(10)12(11(15)16)14-5-6-17-12/h3-4,7,14H,2,5-6H2,1H3.
What are the key properties of 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one?
1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one has a molecular weight of 252.31 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one is sourced from PubChem (CID 24714513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).