About 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol
1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol (PubChem CID 24714910) has the molecular formula C16H23ClN2O3
and a molecular weight of 326.82 g/mol. Its IUPAC name is 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol.
Molecular Properties
| Compound Name | 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol |
| PubChem CID | 24714910 |
| Molecular Formula | C16H23ClN2O3 |
| Molecular Weight | 326.82 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol |
| SMILES | CCN(CC(O)COC)CC1CC(c2ccc(Cl)cc2)=NO1 |
| InChI | InChI=1S/C16H23ClN2O3/c1-3-19(9-14(20)11-21-2)10-15-8-16(18-22-15)12-4-6-13(17)7-5-12/h4-7,14-15,20H,3,8-11H2,1-2H3 |
| InChIKey | YONBYFXSRTWHAK-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.82 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol?
The IUPAC name of 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol (CID 24714910) is 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol.
What is the SMILES notation for 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol?
The canonical SMILES for 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol is CCN(CC(O)COC)CC1CC(c2ccc(Cl)cc2)=NO1.
What is the InChIKey of 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol?
The InChIKey is YONBYFXSRTWHAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClN2O3/c1-3-19(9-14(20)11-21-2)10-15-8-16(18-22-15)12-4-6-13(17)7-5-12/h4-7,14-15,20H,3,8-11H2,1-2H3.
What are the key properties of 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol?
1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol has a molecular weight of 326.82 g/mol, XLogP of 2.16, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[3-(4-chlorophenyl)-4,5-dihydro-1,2-oxazol-5-yl]methyl-ethylamino]-3-methoxypropan-2-ol is sourced from PubChem (CID 24714910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).