About 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one
3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one (PubChem CID 24714985) has the molecular formula C18H21FN2O2S
and a molecular weight of 348.44 g/mol. Its IUPAC name is 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one |
| PubChem CID | 24714985 |
| Molecular Formula | C18H21FN2O2S |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one |
| SMILES | CCN1C(=O)C2(SCCN2C(=O)C2CCCC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C18H21FN2O2S/c1-2-20-15-8-7-13(19)11-14(15)18(17(20)23)21(9-10-24-18)16(22)12-5-3-4-6-12/h7-8,11-12H,2-6,9-10H2,1H3 |
| InChIKey | ZNTNOINLMOFWCM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one?
The IUPAC name of 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one (CID 24714985) is 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one.
What is the SMILES notation for 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one?
The canonical SMILES for 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one is CCN1C(=O)C2(SCCN2C(=O)C2CCCC2)c2cc(F)ccc21.
What is the InChIKey of 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one?
The InChIKey is ZNTNOINLMOFWCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21FN2O2S/c1-2-20-15-8-7-13(19)11-14(15)18(17(20)23)21(9-10-24-18)16(22)12-5-3-4-6-12/h7-8,11-12H,2-6,9-10H2,1H3.
What are the key properties of 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one?
3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one has a molecular weight of 348.44 g/mol, XLogP of 3.11, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclopentanecarbonyl)-1'-ethyl-5'-fluorospiro[1,3-thiazolidine-2,3'-indole]-2'-one is sourced from PubChem (CID 24714985), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).