C17H19ClN4O2 — CID 24715350
1-[4-[6-(4-chloro-3-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanone (PubChem CID 24715350) has the molecular formula C17H19ClN4O2 and a molecular weight of 346.82 g/mol. Its IUPAC name is 1-[4-[6-(4-chloro-3-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[6-(4-chloro-3-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 24715350 |
| Molecular Formula | C17H19ClN4O2 |
| Molecular Weight | 346.82 g/mol |
| Exact Mass | 346.12 |
| IUPAC Name | 1-[4-[6-(4-chloro-3-methylphenoxy)pyrimidin-4-yl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2cc(Oc3ccc(Cl)c(C)c3)ncn2)CC1 |
| InChI | InChI=1S/C17H19ClN4O2/c1-12-9-14(3-4-15(12)18)24-17-10-16(19-11-20-17)22-7-5-21(6-8-22)13(2)23/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | MTVVPRUHCSLCCR-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.82 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |