About 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one
5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one (PubChem CID 24715488) has the molecular formula C18H27N3OS
and a molecular weight of 333.50 g/mol. Its IUPAC name is 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one.
Molecular Properties
| Compound Name | 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one |
| PubChem CID | 24715488 |
| Molecular Formula | C18H27N3OS |
| Molecular Weight | 333.50 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one |
| SMILES | CCC1SC(c2ccccc2C)N(CCN2CCNCC2)C1=O |
| InChI | InChI=1S/C18H27N3OS/c1-3-16-17(22)21(13-12-20-10-8-19-9-11-20)18(23-16)15-7-5-4-6-14(15)2/h4-7,16,18-19H,3,8-13H2,1-2H3 |
| InChIKey | AFOYYPNTBDBADZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.50 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one?
The IUPAC name of 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one (CID 24715488) is 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one.
What is the SMILES notation for 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one?
The canonical SMILES for 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one is CCC1SC(c2ccccc2C)N(CCN2CCNCC2)C1=O.
What is the InChIKey of 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one?
The InChIKey is AFOYYPNTBDBADZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27N3OS/c1-3-16-17(22)21(13-12-20-10-8-19-9-11-20)18(23-16)15-7-5-4-6-14(15)2/h4-7,16,18-19H,3,8-13H2,1-2H3.
What are the key properties of 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one?
5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one has a molecular weight of 333.50 g/mol, XLogP of 2.25, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2-(2-methylphenyl)-3-(2-piperazin-1-ylethyl)-1,3-thiazolidin-4-one is sourced from PubChem (CID 24715488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).