About N-cyclopentyl-2,4-difluorobenzenesulfonamide
N-cyclopentyl-2,4-difluorobenzenesulfonamide (PubChem CID 2471611) has the molecular formula C11H13F2NO2S
and a molecular weight of 261.29 g/mol. Its IUPAC name is N-cyclopentyl-2,4-difluorobenzenesulfonamide.
Molecular Properties
| Compound Name | N-cyclopentyl-2,4-difluorobenzenesulfonamide |
| PubChem CID | 2471611 |
| Molecular Formula | C11H13F2NO2S |
| Molecular Weight | 261.29 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | N-cyclopentyl-2,4-difluorobenzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCC1)c1ccc(F)cc1F |
| InChI | InChI=1S/C11H13F2NO2S/c12-8-5-6-11(10(13)7-8)17(15,16)14-9-3-1-2-4-9/h5-7,9,14H,1-4H2 |
| InChIKey | XFBZKEJJECGKAJ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 261.29 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-cyclopentyl-2,4-difluorobenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclopentyl-2,4-difluorobenzenesulfonamide?
The IUPAC name of N-cyclopentyl-2,4-difluorobenzenesulfonamide (CID 2471611) is N-cyclopentyl-2,4-difluorobenzenesulfonamide.
What is the SMILES notation for N-cyclopentyl-2,4-difluorobenzenesulfonamide?
The canonical SMILES for N-cyclopentyl-2,4-difluorobenzenesulfonamide is O=S(=O)(NC1CCCC1)c1ccc(F)cc1F.
What is the InChIKey of N-cyclopentyl-2,4-difluorobenzenesulfonamide?
The InChIKey is XFBZKEJJECGKAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13F2NO2S/c12-8-5-6-11(10(13)7-8)17(15,16)14-9-3-1-2-4-9/h5-7,9,14H,1-4H2.
What are the key properties of N-cyclopentyl-2,4-difluorobenzenesulfonamide?
N-cyclopentyl-2,4-difluorobenzenesulfonamide has a molecular weight of 261.29 g/mol, XLogP of 2.19, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclopentyl-2,4-difluorobenzenesulfonamide is sourced from PubChem (CID 2471611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).