C23H35N3O2 — CID 2471622
2-[4-(4-methoxyphenyl)piperazin-1-yl]-1-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone (PubChem CID 2471622) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone.
| Compound Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
|---|---|
| PubChem CID | 2471622 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 2-[4-(4-methoxyphenyl)piperazin-1-yl]-1-[(1S,5R)-1,3,3-trimethyl-6-azabicyclo[3.2.1]octan-6-yl]ethanone |
| SMILES | COc1ccc(N2CCN(CC(=O)N3C[C@]4(C)C[C@H]3CC(C)(C)C4)CC2)cc1 |
| InChI | InChI=1S/C23H35N3O2/c1-22(2)13-19-14-23(3,16-22)17-26(19)21(27)15-24-9-11-25(12-10-24)18-5-7-20(28-4)8-6-18/h5-8,19H,9-17H2,1-4H3/t19-,23-/m1/s1 |
| InChIKey | MULAHAZSZQTXPM-AUSIDOKSSA-N |
| XLogP | 3.24 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|