C16H22ClN3O2 — CID 24716736
N-tert-butyl-4-(2-chlorophenyl)-2-methyl-3-oxopiperazine-1-carboxamide (PubChem CID 24716736) has the molecular formula C16H22ClN3O2 and a molecular weight of 323.82 g/mol. Its IUPAC name is N-tert-butyl-4-(2-chlorophenyl)-2-methyl-3-oxopiperazine-1-carboxamide.
| Compound Name | N-tert-butyl-4-(2-chlorophenyl)-2-methyl-3-oxopiperazine-1-carboxamide |
|---|---|
| PubChem CID | 24716736 |
| Molecular Formula | C16H22ClN3O2 |
| Molecular Weight | 323.82 g/mol |
| Exact Mass | 323.14 |
| IUPAC Name | N-tert-butyl-4-(2-chlorophenyl)-2-methyl-3-oxopiperazine-1-carboxamide |
| SMILES | CC1C(=O)N(c2ccccc2Cl)CCN1C(=O)NC(C)(C)C |
| InChI | InChI=1S/C16H22ClN3O2/c1-11-14(21)20(13-8-6-5-7-12(13)17)10-9-19(11)15(22)18-16(2,3)4/h5-8,11H,9-10H2,1-4H3,(H,18,22) |
| InChIKey | SUGOTMVPDJOKEV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.82 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |