C20H38N4O3 — CID 24719241
2-cyclopentyl-N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyacetyl)piperazin-1-yl]acetamide (PubChem CID 24719241) has the molecular formula C20H38N4O3 and a molecular weight of 382.55 g/mol. Its IUPAC name is 2-cyclopentyl-N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyacetyl)piperazin-1-yl]acetamide.
| Compound Name | 2-cyclopentyl-N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyacetyl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 24719241 |
| Molecular Formula | C20H38N4O3 |
| Molecular Weight | 382.55 g/mol |
| Exact Mass | 382.29 |
| IUPAC Name | 2-cyclopentyl-N-[2-(diethylamino)ethyl]-2-[4-(2-methoxyacetyl)piperazin-1-yl]acetamide |
| SMILES | CCN(CC)CCNC(=O)C(C1CCCC1)N1CCN(C(=O)COC)CC1 |
| InChI | InChI=1S/C20H38N4O3/c1-4-22(5-2)11-10-21-20(26)19(17-8-6-7-9-17)24-14-12-23(13-15-24)18(25)16-27-3/h17,19H,4-16H2,1-3H3,(H,21,26) |
| InChIKey | WPTKOVMYSXAYIK-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.55 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |