C28H21F3N2O2 — CID 24720754
(E)-N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 24720754) has the molecular formula C28H21F3N2O2 and a molecular weight of 474.48 g/mol. Its IUPAC name is (E)-N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 24720754 |
| Molecular Formula | C28H21F3N2O2 |
| Molecular Weight | 474.48 g/mol |
| Exact Mass | 474.16 |
| IUPAC Name | (E)-N-[4-(4,5-dihydrobenzo[g][2,1]benzoxazol-3-yl)phenyl]-N-methyl-3-[3-(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1cccc(C(F)(F)F)c1)c1ccc(-c2onc3c2CCc2ccccc2-3)cc1 |
| InChI | InChI=1S/C28H21F3N2O2/c1-33(25(34)16-9-18-5-4-7-21(17-18)28(29,30)31)22-13-10-20(11-14-22)27-24-15-12-19-6-2-3-8-23(19)26(24)32-35-27/h2-11,13-14,16-17H,12,15H2,1H3/b16-9+ |
| InChIKey | VKPUDFLGGMGSCK-CXUHLZMHSA-N |
| XLogP | 6.80 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.48 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|