About 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide
3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide (PubChem CID 2472081) has the molecular formula C21H21N3O3
and a molecular weight of 363.42 g/mol. Its IUPAC name is 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide |
| PubChem CID | 2472081 |
| Molecular Formula | C21H21N3O3 |
| Molecular Weight | 363.42 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)Nc1ccccc1C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C21H21N3O3/c1-14-19(15(2)27-24-14)21(26)23-18-11-7-6-10-17(18)20(25)22-13-12-16-8-4-3-5-9-16/h3-11H,12-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | JGLJPPVGCIYDIH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide?
The IUPAC name of 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide (CID 2472081) is 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide.
What is the SMILES notation for 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide?
The canonical SMILES for 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide is Cc1noc(C)c1C(=O)Nc1ccccc1C(=O)NCCc1ccccc1.
What is the InChIKey of 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide?
The InChIKey is JGLJPPVGCIYDIH-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3O3/c1-14-19(15(2)27-24-14)21(26)23-18-11-7-6-10-17(18)20(25)22-13-12-16-8-4-3-5-9-16/h3-11H,12-13H2,1-2H3,(H,22,25)(H,23,26).
What are the key properties of 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide?
3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide has a molecular weight of 363.42 g/mol, XLogP of 3.52, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-N-[2-(2-phenylethylcarbamoyl)phenyl]-1,2-oxazole-4-carboxamide is sourced from PubChem (CID 2472081), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).