About 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene
1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene (PubChem CID 24721128) has the molecular formula C16H15BrO2
and a molecular weight of 319.20 g/mol. Its IUPAC name is 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene.
Molecular Properties
| Compound Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene |
| PubChem CID | 24721128 |
| Molecular Formula | C16H15BrO2 |
| Molecular Weight | 319.20 g/mol |
| Exact Mass | 318.03 |
| IUPAC Name | 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene |
| SMILES | COc1cc(/C=C/c2ccc(Br)cc2)cc(OC)c1 |
| InChI | InChI=1S/C16H15BrO2/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12/h3-11H,1-2H3/b4-3+ |
| InChIKey | LNIXLDMNAZUUGL-ONEGZZNKSA-N |
| XLogP | 4.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.20 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene?
The IUPAC name of 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene (CID 24721128) is 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene.
What is the SMILES notation for 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene?
The canonical SMILES for 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene is COc1cc(/C=C/c2ccc(Br)cc2)cc(OC)c1.
What is the InChIKey of 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene?
The InChIKey is LNIXLDMNAZUUGL-ONEGZZNKSA-N. The full InChI is InChI=1S/C16H15BrO2/c1-18-15-9-13(10-16(11-15)19-2)4-3-12-5-7-14(17)8-6-12/h3-11H,1-2H3/b4-3+.
What are the key properties of 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene?
1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene has a molecular weight of 319.20 g/mol, XLogP of 4.64, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-2-(4-bromophenyl)ethenyl]-3,5-dimethoxybenzene is sourced from PubChem (CID 24721128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).