About 3-amino-4-bromophenol
3-amino-4-bromophenol (PubChem CID 24721534) has the molecular formula C6H6BrNO
and a molecular weight of 188.02 g/mol. Its IUPAC name is 3-amino-4-bromophenol.
Molecular Properties
| Compound Name | 3-amino-4-bromophenol |
| PubChem CID | 24721534 |
| Molecular Formula | C6H6BrNO |
| Molecular Weight | 188.02 g/mol |
| Exact Mass | 186.96 |
| IUPAC Name | 3-amino-4-bromophenol |
| SMILES | Nc1cc(O)ccc1Br |
| InChI | InChI=1S/C6H6BrNO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H,8H2 |
| InChIKey | JJNOHJJIVAVDLP-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.02 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-bromophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-bromophenol?
The IUPAC name of 3-amino-4-bromophenol (CID 24721534) is 3-amino-4-bromophenol.
What is the SMILES notation for 3-amino-4-bromophenol?
The canonical SMILES for 3-amino-4-bromophenol is Nc1cc(O)ccc1Br.
What is the InChIKey of 3-amino-4-bromophenol?
The InChIKey is JJNOHJJIVAVDLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6BrNO/c7-5-2-1-4(9)3-6(5)8/h1-3,9H,8H2.
What are the key properties of 3-amino-4-bromophenol?
3-amino-4-bromophenol has a molecular weight of 188.02 g/mol, XLogP of 1.74, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-bromophenol is sourced from PubChem (CID 24721534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).