About tert-butyl acetate;chlorozinc(1+)
tert-butyl acetate;chlorozinc(1+) (PubChem CID 24722599) has the molecular formula C6H11ClO2Zn
and a molecular weight of 215.99 g/mol. Its IUPAC name is tert-butyl acetate;chlorozinc(1+).
Molecular Properties
| Compound Name | tert-butyl acetate;chlorozinc(1+) |
| PubChem CID | 24722599 |
| Molecular Formula | C6H11ClO2Zn |
| Molecular Weight | 215.99 g/mol |
| Exact Mass | 213.97 |
| IUPAC Name | tert-butyl acetate;chlorozinc(1+) |
| SMILES | Cl[Zn+].[CH2-]C(=O)OC(C)(C)C |
| InChI | InChI=1S/C6H11O2.ClH.Zn/c1-5(7)8-6(2,3)4;;/h1H2,2-4H3;1H;/q-1;;+2/p-1 |
| InChIKey | MWRBWPQBGGARAY-UHFFFAOYSA-M |
| XLogP | 1.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.99 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl acetate;chlorozinc(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl acetate;chlorozinc(1+)?
The IUPAC name of tert-butyl acetate;chlorozinc(1+) (CID 24722599) is tert-butyl acetate;chlorozinc(1+).
What is the SMILES notation for tert-butyl acetate;chlorozinc(1+)?
The canonical SMILES for tert-butyl acetate;chlorozinc(1+) is Cl[Zn+].[CH2-]C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl acetate;chlorozinc(1+)?
The InChIKey is MWRBWPQBGGARAY-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H11O2.ClH.Zn/c1-5(7)8-6(2,3)4;;/h1H2,2-4H3;1H;/q-1;;+2/p-1.
What are the key properties of tert-butyl acetate;chlorozinc(1+)?
tert-butyl acetate;chlorozinc(1+) has a molecular weight of 215.99 g/mol, XLogP of 1.85, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl acetate;chlorozinc(1+) is sourced from PubChem (CID 24722599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).