About iodozinc(1+);1-(phenylmethyl)pyrrolidine
iodozinc(1+);1-(phenylmethyl)pyrrolidine (PubChem CID 24722639) has the molecular formula C11H14INZn
and a molecular weight of 352.53 g/mol. Its IUPAC name is iodozinc(1+);1-(phenylmethyl)pyrrolidine.
Molecular Properties
| Compound Name | iodozinc(1+);1-(phenylmethyl)pyrrolidine |
| PubChem CID | 24722639 |
| Molecular Formula | C11H14INZn |
| Molecular Weight | 352.53 g/mol |
| Exact Mass | 350.95 |
| IUPAC Name | iodozinc(1+);1-(phenylmethyl)pyrrolidine |
| SMILES | [Zn+]I.[c-]1ccccc1CN1CCCC1 |
| InChI | InChI=1S/C11H14N.HI.Zn/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;;/h1-3,6H,4-5,8-10H2;1H;/q-1;;+2/p-1 |
| InChIKey | KASYUTOIYYNQHA-UHFFFAOYSA-M |
| XLogP | 2.97 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.53 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze iodozinc(1+);1-(phenylmethyl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of iodozinc(1+);1-(phenylmethyl)pyrrolidine?
The IUPAC name of iodozinc(1+);1-(phenylmethyl)pyrrolidine (CID 24722639) is iodozinc(1+);1-(phenylmethyl)pyrrolidine.
What is the SMILES notation for iodozinc(1+);1-(phenylmethyl)pyrrolidine?
The canonical SMILES for iodozinc(1+);1-(phenylmethyl)pyrrolidine is [Zn+]I.[c-]1ccccc1CN1CCCC1.
What is the InChIKey of iodozinc(1+);1-(phenylmethyl)pyrrolidine?
The InChIKey is KASYUTOIYYNQHA-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H14N.HI.Zn/c1-2-6-11(7-3-1)10-12-8-4-5-9-12;;/h1-3,6H,4-5,8-10H2;1H;/q-1;;+2/p-1.
What are the key properties of iodozinc(1+);1-(phenylmethyl)pyrrolidine?
iodozinc(1+);1-(phenylmethyl)pyrrolidine has a molecular weight of 352.53 g/mol, XLogP of 2.97, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for iodozinc(1+);1-(phenylmethyl)pyrrolidine is sourced from PubChem (CID 24722639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).