About 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one
2-methyl-1-(1,3-oxazol-2-yl)propan-1-one (PubChem CID 24723617) has the molecular formula C7H9NO2
and a molecular weight of 139.15 g/mol. Its IUPAC name is 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one.
Molecular Properties
| Compound Name | 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one |
| PubChem CID | 24723617 |
| Molecular Formula | C7H9NO2 |
| Molecular Weight | 139.15 g/mol |
| Exact Mass | 139.06 |
| IUPAC Name | 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one |
| SMILES | CC(C)C(=O)c1ncco1 |
| InChI | InChI=1S/C7H9NO2/c1-5(2)6(9)7-8-3-4-10-7/h3-5H,1-2H3 |
| InChIKey | PUYVQDCWEITXJJ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.15 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one?
The IUPAC name of 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one (CID 24723617) is 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one.
What is the SMILES notation for 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one?
The canonical SMILES for 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one is CC(C)C(=O)c1ncco1.
What is the InChIKey of 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one?
The InChIKey is PUYVQDCWEITXJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO2/c1-5(2)6(9)7-8-3-4-10-7/h3-5H,1-2H3.
What are the key properties of 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one?
2-methyl-1-(1,3-oxazol-2-yl)propan-1-one has a molecular weight of 139.15 g/mol, XLogP of 1.51, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-1-(1,3-oxazol-2-yl)propan-1-one is sourced from PubChem (CID 24723617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).