C18H15F2NO — CID 24725111
(2,4-difluorophenyl)-[3-(2,5-dihydropyrrol-1-ylmethyl)phenyl]methanone (PubChem CID 24725111) has the molecular formula C18H15F2NO and a molecular weight of 299.32 g/mol. Its IUPAC name is (2,4-difluorophenyl)-[3-(2,5-dihydropyrrol-1-ylmethyl)phenyl]methanone.
| Compound Name | (2,4-difluorophenyl)-[3-(2,5-dihydropyrrol-1-ylmethyl)phenyl]methanone |
|---|---|
| PubChem CID | 24725111 |
| Molecular Formula | C18H15F2NO |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.11 |
| IUPAC Name | (2,4-difluorophenyl)-[3-(2,5-dihydropyrrol-1-ylmethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(CN2CC=CC2)c1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H15F2NO/c19-15-6-7-16(17(20)11-15)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h1-7,10-11H,8-9,12H2 |
| InChIKey | NHHKKKLKNJVPGJ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|