C15H9F5O — CID 24726642
1-(3,4-difluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one (PubChem CID 24726642) has the molecular formula C15H9F5O and a molecular weight of 300.23 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one.
| Compound Name | 1-(3,4-difluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 24726642 |
| Molecular Formula | C15H9F5O |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | 1-(3,4-difluorophenyl)-3-(3,4,5-trifluorophenyl)propan-1-one |
| SMILES | O=C(CCc1cc(F)c(F)c(F)c1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C15H9F5O/c16-10-3-2-9(7-11(10)17)14(21)4-1-8-5-12(18)15(20)13(19)6-8/h2-3,5-7H,1,4H2 |
| InChIKey | RFAVYQVFLWISJY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|