About (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone
(3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone (PubChem CID 24726716) has the molecular formula C16H13BrO3
and a molecular weight of 333.18 g/mol. Its IUPAC name is (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone.
Molecular Properties
| Compound Name | (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone |
| PubChem CID | 24726716 |
| Molecular Formula | C16H13BrO3 |
| Molecular Weight | 333.18 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(C2OCCO2)cc1)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H13BrO3/c17-14-3-1-2-13(10-14)15(18)11-4-6-12(7-5-11)16-19-8-9-20-16/h1-7,10,16H,8-9H2 |
| InChIKey | VSRZSEWGZUJJHG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.18 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone?
The IUPAC name of (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone (CID 24726716) is (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone.
What is the SMILES notation for (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone?
The canonical SMILES for (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone is O=C(c1ccc(C2OCCO2)cc1)c1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone?
The InChIKey is VSRZSEWGZUJJHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13BrO3/c17-14-3-1-2-13(10-14)15(18)11-4-6-12(7-5-11)16-19-8-9-20-16/h1-7,10,16H,8-9H2.
What are the key properties of (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone?
(3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone has a molecular weight of 333.18 g/mol, XLogP of 3.73, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)-[4-(1,3-dioxolan-2-yl)phenyl]methanone is sourced from PubChem (CID 24726716), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).