About cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone
cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone (PubChem CID 24726750) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone.
Molecular Properties
| Compound Name | cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone |
| PubChem CID | 24726750 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone |
| SMILES | O=C(c1ccc(C2OCCO2)cc1)C1CCCC1 |
| InChI | InChI=1S/C15H18O3/c16-14(11-3-1-2-4-11)12-5-7-13(8-6-12)15-17-9-10-18-15/h5-8,11,15H,1-4,9-10H2 |
| InChIKey | BWTSBMHNLIOJAL-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone?
The IUPAC name of cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone (CID 24726750) is cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone.
What is the SMILES notation for cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone?
The canonical SMILES for cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone is O=C(c1ccc(C2OCCO2)cc1)C1CCCC1.
What is the InChIKey of cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone?
The InChIKey is BWTSBMHNLIOJAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3/c16-14(11-3-1-2-4-11)12-5-7-13(8-6-12)15-17-9-10-18-15/h5-8,11,15H,1-4,9-10H2.
What are the key properties of cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone?
cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone has a molecular weight of 246.31 g/mol, XLogP of 3.10, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopentyl-[4-(1,3-dioxolan-2-yl)phenyl]methanone is sourced from PubChem (CID 24726750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).