About 4-nitro-1,2-dihydroindazol-3-one
4-nitro-1,2-dihydroindazol-3-one (PubChem CID 24728192) has the molecular formula C7H5N3O3
and a molecular weight of 179.14 g/mol. Its IUPAC name is 4-nitro-1,2-dihydroindazol-3-one.
Molecular Properties
| Compound Name | 4-nitro-1,2-dihydroindazol-3-one |
| PubChem CID | 24728192 |
| Molecular Formula | C7H5N3O3 |
| Molecular Weight | 179.14 g/mol |
| Exact Mass | 179.03 |
| IUPAC Name | 4-nitro-1,2-dihydroindazol-3-one |
| SMILES | O=c1[nH][nH]c2cccc([N+](=O)[O-])c12 |
| InChI | InChI=1S/C7H5N3O3/c11-7-6-4(8-9-7)2-1-3-5(6)10(12)13/h1-3H,(H2,8,9,11) |
| InChIKey | JIYHKUVJNVDYQH-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 91.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.14 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-1,2-dihydroindazol-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-1,2-dihydroindazol-3-one?
The IUPAC name of 4-nitro-1,2-dihydroindazol-3-one (CID 24728192) is 4-nitro-1,2-dihydroindazol-3-one.
What is the SMILES notation for 4-nitro-1,2-dihydroindazol-3-one?
The canonical SMILES for 4-nitro-1,2-dihydroindazol-3-one is O=c1[nH][nH]c2cccc([N+](=O)[O-])c12.
What is the InChIKey of 4-nitro-1,2-dihydroindazol-3-one?
The InChIKey is JIYHKUVJNVDYQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3O3/c11-7-6-4(8-9-7)2-1-3-5(6)10(12)13/h1-3H,(H2,8,9,11).
What are the key properties of 4-nitro-1,2-dihydroindazol-3-one?
4-nitro-1,2-dihydroindazol-3-one has a molecular weight of 179.14 g/mol, XLogP of 0.76, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-1,2-dihydroindazol-3-one is sourced from PubChem (CID 24728192), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).