About 4-iodo-1H-indazole
4-iodo-1H-indazole (PubChem CID 24728219) has the molecular formula C7H5IN2
and a molecular weight of 244.04 g/mol. Its IUPAC name is 4-iodo-1H-indazole.
Molecular Properties
| Compound Name | 4-iodo-1H-indazole |
| PubChem CID | 24728219 |
| Molecular Formula | C7H5IN2 |
| Molecular Weight | 244.04 g/mol |
| Exact Mass | 243.95 |
| IUPAC Name | 4-iodo-1H-indazole |
| SMILES | Ic1cccc2[nH]ncc12 |
| InChI | InChI=1S/C7H5IN2/c8-6-2-1-3-7-5(6)4-9-10-7/h1-4H,(H,9,10) |
| InChIKey | CJQXSPSUIGJNJX-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.04 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-iodo-1H-indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-iodo-1H-indazole?
The IUPAC name of 4-iodo-1H-indazole (CID 24728219) is 4-iodo-1H-indazole.
What is the SMILES notation for 4-iodo-1H-indazole?
The canonical SMILES for 4-iodo-1H-indazole is Ic1cccc2[nH]ncc12.
What is the InChIKey of 4-iodo-1H-indazole?
The InChIKey is CJQXSPSUIGJNJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5IN2/c8-6-2-1-3-7-5(6)4-9-10-7/h1-4H,(H,9,10).
What are the key properties of 4-iodo-1H-indazole?
4-iodo-1H-indazole has a molecular weight of 244.04 g/mol, XLogP of 2.17, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-iodo-1H-indazole is sourced from PubChem (CID 24728219), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).