About 1H-indazol-6-ylboronic acid
1H-indazol-6-ylboronic acid (PubChem CID 24728617) has the molecular formula C7H7BN2O2
and a molecular weight of 161.96 g/mol. Its IUPAC name is 1H-indazol-6-ylboronic acid.
Molecular Properties
| Compound Name | 1H-indazol-6-ylboronic acid |
| PubChem CID | 24728617 |
| Molecular Formula | C7H7BN2O2 |
| Molecular Weight | 161.96 g/mol |
| Exact Mass | 162.06 |
| IUPAC Name | 1H-indazol-6-ylboronic acid |
| SMILES | OB(O)c1ccc2cn[nH]c2c1 |
| InChI | InChI=1S/C7H7BN2O2/c11-8(12)6-2-1-5-4-9-10-7(5)3-6/h1-4,11-12H,(H,9,10) |
| InChIKey | ZKNLCHWRWRYPGG-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.96 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1H-indazol-6-ylboronic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-indazol-6-ylboronic acid?
The IUPAC name of 1H-indazol-6-ylboronic acid (CID 24728617) is 1H-indazol-6-ylboronic acid.
What is the SMILES notation for 1H-indazol-6-ylboronic acid?
The canonical SMILES for 1H-indazol-6-ylboronic acid is OB(O)c1ccc2cn[nH]c2c1.
What is the InChIKey of 1H-indazol-6-ylboronic acid?
The InChIKey is ZKNLCHWRWRYPGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7BN2O2/c11-8(12)6-2-1-5-4-9-10-7(5)3-6/h1-4,11-12H,(H,9,10).
What are the key properties of 1H-indazol-6-ylboronic acid?
1H-indazol-6-ylboronic acid has a molecular weight of 161.96 g/mol, XLogP of -0.76, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-indazol-6-ylboronic acid is sourced from PubChem (CID 24728617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).