C8H11N3 — CID 24729202
4-(1H-imidazol-5-yl)-1,2,3,6-tetrahydropyridine (PubChem CID 24729202) has the molecular formula C8H11N3 and a molecular weight of 149.20 g/mol. Its IUPAC name is 4-(1H-imidazol-5-yl)-1,2,3,6-tetrahydropyridine.
| Compound Name | 4-(1H-imidazol-5-yl)-1,2,3,6-tetrahydropyridine |
|---|---|
| PubChem CID | 24729202 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 4-(1H-imidazol-5-yl)-1,2,3,6-tetrahydropyridine |
| SMILES | C1=C(c2cnc[nH]2)CCNC1 |
| InChI | InChI=1S/C8H11N3/c1-3-9-4-2-7(1)8-5-10-6-11-8/h1,5-6,9H,2-4H2,(H,10,11) |
| InChIKey | NYMBHXQAMFVNIG-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |