About 6-bromo-1H-pyrrolo[3,2-c]pyridine
6-bromo-1H-pyrrolo[3,2-c]pyridine (PubChem CID 24729218) has the molecular formula C7H5BrN2
and a molecular weight of 197.04 g/mol. Its IUPAC name is 6-bromo-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 6-bromo-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 24729218 |
| Molecular Formula | C7H5BrN2 |
| Molecular Weight | 197.04 g/mol |
| Exact Mass | 195.96 |
| IUPAC Name | 6-bromo-1H-pyrrolo[3,2-c]pyridine |
| SMILES | Brc1cc2[nH]ccc2cn1 |
| InChI | InChI=1S/C7H5BrN2/c8-7-3-6-5(4-10-7)1-2-9-6/h1-4,9H |
| InChIKey | IRXFHLHFJHIJTO-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.04 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of 6-bromo-1H-pyrrolo[3,2-c]pyridine (CID 24729218) is 6-bromo-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 6-bromo-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for 6-bromo-1H-pyrrolo[3,2-c]pyridine is Brc1cc2[nH]ccc2cn1.
What is the InChIKey of 6-bromo-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is IRXFHLHFJHIJTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5BrN2/c8-7-3-6-5(4-10-7)1-2-9-6/h1-4,9H.
What are the key properties of 6-bromo-1H-pyrrolo[3,2-c]pyridine?
6-bromo-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 197.04 g/mol, XLogP of 2.33, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 24729218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).