About 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine
4,7-dibromo-1H-pyrrolo[3,2-c]pyridine (PubChem CID 24729441) has the molecular formula C7H4Br2N2
and a molecular weight of 275.93 g/mol. Its IUPAC name is 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine |
| PubChem CID | 24729441 |
| Molecular Formula | C7H4Br2N2 |
| Molecular Weight | 275.93 g/mol |
| Exact Mass | 273.87 |
| IUPAC Name | 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine |
| SMILES | Brc1ncc(Br)c2[nH]ccc12 |
| InChI | InChI=1S/C7H4Br2N2/c8-5-3-11-7(9)4-1-2-10-6(4)5/h1-3,10H |
| InChIKey | XNNGGUSSDILPAQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.93 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine?
The IUPAC name of 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine (CID 24729441) is 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine.
What is the SMILES notation for 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine?
The canonical SMILES for 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine is Brc1ncc(Br)c2[nH]ccc12.
What is the InChIKey of 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine?
The InChIKey is XNNGGUSSDILPAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4Br2N2/c8-5-3-11-7(9)4-1-2-10-6(4)5/h1-3,10H.
What are the key properties of 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine?
4,7-dibromo-1H-pyrrolo[3,2-c]pyridine has a molecular weight of 275.93 g/mol, XLogP of 3.09, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,7-dibromo-1H-pyrrolo[3,2-c]pyridine is sourced from PubChem (CID 24729441), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).