About 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone
1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone (PubChem CID 24729506) has the molecular formula C10H9BrClNO
and a molecular weight of 274.54 g/mol. Its IUPAC name is 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone |
| PubChem CID | 24729506 |
| Molecular Formula | C10H9BrClNO |
| Molecular Weight | 274.54 g/mol |
| Exact Mass | 272.96 |
| IUPAC Name | 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone |
| SMILES | CC(=O)N1CCc2cc(Cl)cc(Br)c21 |
| InChI | InChI=1S/C10H9BrClNO/c1-6(14)13-3-2-7-4-8(12)5-9(11)10(7)13/h4-5H,2-3H2,1H3 |
| InChIKey | BZUAZYHWTWYEKC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.54 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone?
The IUPAC name of 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone (CID 24729506) is 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone.
What is the SMILES notation for 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone?
The canonical SMILES for 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone is CC(=O)N1CCc2cc(Cl)cc(Br)c21.
What is the InChIKey of 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone?
The InChIKey is BZUAZYHWTWYEKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9BrClNO/c1-6(14)13-3-2-7-4-8(12)5-9(11)10(7)13/h4-5H,2-3H2,1H3.
What are the key properties of 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone?
1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone has a molecular weight of 274.54 g/mol, XLogP of 3.01, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(7-bromo-5-chloro-2,3-dihydroindol-1-yl)ethanone is sourced from PubChem (CID 24729506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).