About 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine
3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine (PubChem CID 24729570) has the molecular formula C7H4BrClN2
and a molecular weight of 231.48 g/mol. Its IUPAC name is 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine.
Molecular Properties
| Compound Name | 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine |
| PubChem CID | 24729570 |
| Molecular Formula | C7H4BrClN2 |
| Molecular Weight | 231.48 g/mol |
| Exact Mass | 229.92 |
| IUPAC Name | 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine |
| SMILES | Clc1ccnc2[nH]cc(Br)c12 |
| InChI | InChI=1S/C7H4BrClN2/c8-4-3-11-7-6(4)5(9)1-2-10-7/h1-3H,(H,10,11) |
| InChIKey | QLGXTRWCWHBPDP-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.48 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine?
The IUPAC name of 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine (CID 24729570) is 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine.
What is the SMILES notation for 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine?
The canonical SMILES for 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine is Clc1ccnc2[nH]cc(Br)c12.
What is the InChIKey of 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine?
The InChIKey is QLGXTRWCWHBPDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H4BrClN2/c8-4-3-11-7-6(4)5(9)1-2-10-7/h1-3H,(H,10,11).
What are the key properties of 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine?
3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine has a molecular weight of 231.48 g/mol, XLogP of 2.98, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-chloro-1H-pyrrolo[2,3-b]pyridine is sourced from PubChem (CID 24729570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).