About 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile
6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile (PubChem CID 24729592) has the molecular formula C8H4BrN3
and a molecular weight of 222.05 g/mol. Its IUPAC name is 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile.
Molecular Properties
| Compound Name | 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile |
| PubChem CID | 24729592 |
| Molecular Formula | C8H4BrN3 |
| Molecular Weight | 222.05 g/mol |
| Exact Mass | 220.96 |
| IUPAC Name | 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(Br)nc2[nH]ccc12 |
| InChI | InChI=1S/C8H4BrN3/c9-7-3-5(4-10)6-1-2-11-8(6)12-7/h1-3H,(H,11,12) |
| InChIKey | BOZYLNVZPZHGBQ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.05 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile?
The IUPAC name of 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile (CID 24729592) is 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile.
What is the SMILES notation for 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile?
The canonical SMILES for 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is N#Cc1cc(Br)nc2[nH]ccc12.
What is the InChIKey of 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile?
The InChIKey is BOZYLNVZPZHGBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4BrN3/c9-7-3-5(4-10)6-1-2-11-8(6)12-7/h1-3H,(H,11,12).
What are the key properties of 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile?
6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile has a molecular weight of 222.05 g/mol, XLogP of 2.20, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-1H-pyrrolo[2,3-b]pyridine-4-carbonitrile is sourced from PubChem (CID 24729592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).