C13H17Cl2NO — CID 24730055
4-(Aminomethyl)-4-(3,4-dichlorophenyl)cyclohexanol (PubChem CID 24730055) has the molecular formula C13H17Cl2NO and a molecular weight of 274.18 g/mol. Its IUPAC name is 4-(aminomethyl)-4-(3,4-dichlorophenyl)cyclohexan-1-ol.
| Compound Name | 4-(Aminomethyl)-4-(3,4-dichlorophenyl)cyclohexanol |
|---|---|
| PubChem CID | 24730055 |
| Molecular Formula | C13H17Cl2NO |
| Molecular Weight | 274.18 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 4-(aminomethyl)-4-(3,4-dichlorophenyl)cyclohexan-1-ol |
| SMILES | C1CC(CCC1O)(CN)C2=CC(=C(C=C2)Cl)Cl |
| InChI | InChI=1S/C13H17Cl2NO/c14-11-2-1-9(7-12(11)15)13(8-16)5-3-10(17)4-6-13/h1-2,7,10,17H,3-6,8,16H2 |
| InChIKey | APRZPAJFSXWXIH-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | 254 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |