About [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine
[8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine (PubChem CID 24730063) has the molecular formula C15H20ClNO2
and a molecular weight of 281.78 g/mol. Its IUPAC name is [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine.
Molecular Properties
| Compound Name | [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine |
| PubChem CID | 24730063 |
| Molecular Formula | C15H20ClNO2 |
| Molecular Weight | 281.78 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine |
| SMILES | NCC1(c2cccc(Cl)c2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H20ClNO2/c16-13-3-1-2-12(10-13)14(11-17)4-6-15(7-5-14)18-8-9-19-15/h1-3,10H,4-9,11,17H2 |
| InChIKey | JTNDOFORRPLZQI-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.78 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine?
The IUPAC name of [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine (CID 24730063) is [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine.
What is the SMILES notation for [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine?
The canonical SMILES for [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine is NCC1(c2cccc(Cl)c2)CCC2(CC1)OCCO2.
What is the InChIKey of [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine?
The InChIKey is JTNDOFORRPLZQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20ClNO2/c16-13-3-1-2-12(10-13)14(11-17)4-6-15(7-5-14)18-8-9-19-15/h1-3,10H,4-9,11,17H2.
What are the key properties of [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine?
[8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine has a molecular weight of 281.78 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(3-chlorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine is sourced from PubChem (CID 24730063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).