About [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine
[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine (PubChem CID 24730064) has the molecular formula C15H20FNO2
and a molecular weight of 265.33 g/mol. Its IUPAC name is [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine.
Molecular Properties
| Compound Name | [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine |
| PubChem CID | 24730064 |
| Molecular Formula | C15H20FNO2 |
| Molecular Weight | 265.33 g/mol |
| Exact Mass | 265.15 |
| IUPAC Name | [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine |
| SMILES | NCC1(c2ccc(F)cc2)CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C15H20FNO2/c16-13-3-1-12(2-4-13)14(11-17)5-7-15(8-6-14)18-9-10-19-15/h1-4H,5-11,17H2 |
| InChIKey | XKVYRQNEOUBVQG-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.33 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine?
The IUPAC name of [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine (CID 24730064) is [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine.
What is the SMILES notation for [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine?
The canonical SMILES for [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine is NCC1(c2ccc(F)cc2)CCC2(CC1)OCCO2.
What is the InChIKey of [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine?
The InChIKey is XKVYRQNEOUBVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20FNO2/c16-13-3-1-12(2-4-13)14(11-17)5-7-15(8-6-14)18-9-10-19-15/h1-4H,5-11,17H2.
What are the key properties of [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine?
[8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine has a molecular weight of 265.33 g/mol, XLogP of 2.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [8-(4-fluorophenyl)-1,4-dioxaspiro[4.5]decan-8-yl]methanamine is sourced from PubChem (CID 24730064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).