C26H29F3N4O — CID 24731097
N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,4,5-trifluoro-N-(2-pyrrolidin-1-ylethyl)benzamide (PubChem CID 24731097) has the molecular formula C26H29F3N4O and a molecular weight of 470.54 g/mol. Its IUPAC name is N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,4,5-trifluoro-N-(2-pyrrolidin-1-ylethyl)benzamide.
| Compound Name | N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,4,5-trifluoro-N-(2-pyrrolidin-1-ylethyl)benzamide |
|---|---|
| PubChem CID | 24731097 |
| Molecular Formula | C26H29F3N4O |
| Molecular Weight | 470.54 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,4,5-trifluoro-N-(2-pyrrolidin-1-ylethyl)benzamide |
| SMILES | N#Cc1cccc(CN2CCC(N(CCN3CCCC3)C(=O)c3cc(F)c(F)cc3F)CC2)c1 |
| InChI | InChI=1S/C26H29F3N4O/c27-23-16-25(29)24(28)15-22(23)26(34)33(13-12-31-8-1-2-9-31)21-6-10-32(11-7-21)18-20-5-3-4-19(14-20)17-30/h3-5,14-16,21H,1-2,6-13,18H2 |
| InChIKey | YDEQUDSUMCPBFW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 50.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.54 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|