C26H23F3N4O — CID 24731107
N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,4,5-trifluoro-N-(pyridin-3-ylmethyl)benzamide (PubChem CID 24731107) has the molecular formula C26H23F3N4O and a molecular weight of 464.49 g/mol. Its IUPAC name is N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,4,5-trifluoro-N-(pyridin-3-ylmethyl)benzamide.
| Compound Name | N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,4,5-trifluoro-N-(pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 24731107 |
| Molecular Formula | C26H23F3N4O |
| Molecular Weight | 464.49 g/mol |
| Exact Mass | 464.18 |
| IUPAC Name | N-[1-[(3-cyanophenyl)methyl]piperidin-4-yl]-2,4,5-trifluoro-N-(pyridin-3-ylmethyl)benzamide |
| SMILES | N#Cc1cccc(CN2CCC(N(Cc3cccnc3)C(=O)c3cc(F)c(F)cc3F)CC2)c1 |
| InChI | InChI=1S/C26H23F3N4O/c27-23-13-25(29)24(28)12-22(23)26(34)33(17-20-5-2-8-31-15-20)21-6-9-32(10-7-21)16-19-4-1-3-18(11-19)14-30/h1-5,8,11-13,15,21H,6-7,9-10,16-17H2 |
| InChIKey | MCHMPJWVRBHYOW-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 60.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.49 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|