C25H25N5O4S2 — CID 2473313
6-amino-1,3-dimethyl-5-[2-[[3-(2-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]pyrimidine-2,4-dione (PubChem CID 2473313) has the molecular formula C25H25N5O4S2 and a molecular weight of 523.64 g/mol. Its IUPAC name is 6-amino-1,3-dimethyl-5-[2-[[3-(2-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]pyrimidine-2,4-dione.
| Compound Name | 6-amino-1,3-dimethyl-5-[2-[[3-(2-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 2473313 |
| Molecular Formula | C25H25N5O4S2 |
| Molecular Weight | 523.64 g/mol |
| Exact Mass | 523.13 |
| IUPAC Name | 6-amino-1,3-dimethyl-5-[2-[[3-(2-methylphenyl)-4-oxo-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-2-yl]sulfanyl]acetyl]pyrimidine-2,4-dione |
| SMILES | Cc1ccccc1-n1c(SCC(=O)c2c(N)n(C)c(=O)n(C)c2=O)nc2sc3c(c2c1=O)CCCC3 |
| InChI | InChI=1S/C25H25N5O4S2/c1-13-8-4-6-10-15(13)30-23(33)18-14-9-5-7-11-17(14)36-21(18)27-24(30)35-12-16(31)19-20(26)28(2)25(34)29(3)22(19)32/h4,6,8,10H,5,7,9,11-12,26H2,1-3H3 |
| InChIKey | ZKKBDCXQUOQARJ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 121.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.64 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |