C14H17N3 — CID 24733373
2-methyl-3-phenyl-1,4,8-triazaspiro[4.5]deca-1,3-diene (PubChem CID 24733373) has the molecular formula C14H17N3 and a molecular weight of 227.31 g/mol. Its IUPAC name is 2-methyl-3-phenyl-1,4,8-triazaspiro[4.5]deca-1,3-diene.
| Compound Name | 2-methyl-3-phenyl-1,4,8-triazaspiro[4.5]deca-1,3-diene |
|---|---|
| PubChem CID | 24733373 |
| Molecular Formula | C14H17N3 |
| Molecular Weight | 227.31 g/mol |
| Exact Mass | 227.14 |
| IUPAC Name | 2-methyl-3-phenyl-1,4,8-triazaspiro[4.5]deca-1,3-diene |
| SMILES | CC1=NC2(CCNCC2)N=C1c1ccccc1 |
| InChI | InChI=1S/C14H17N3/c1-11-13(12-5-3-2-4-6-12)17-14(16-11)7-9-15-10-8-14/h2-6,15H,7-10H2,1H3 |
| InChIKey | ZXEATURYXSTYNS-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |