About 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline
8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline (PubChem CID 24733452) has the molecular formula C25H25N5O2
and a molecular weight of 427.51 g/mol. Its IUPAC name is 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline.
Molecular Properties
| Compound Name | 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline |
| PubChem CID | 24733452 |
| Molecular Formula | C25H25N5O2 |
| Molecular Weight | 427.51 g/mol |
| Exact Mass | 427.20 |
| IUPAC Name | 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline |
| SMILES | COc1ccc(-c2cccc3ccc(N4CCN(c5ncccn5)CC4)nc23)c(OC)c1 |
| InChI | InChI=1S/C25H25N5O2/c1-31-19-8-9-20(22(17-19)32-2)21-6-3-5-18-7-10-23(28-24(18)21)29-13-15-30(16-14-29)25-26-11-4-12-27-25/h3-12,17H,13-16H2,1-2H3 |
| InChIKey | KKBMFLRSLROKLX-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 427.51 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline?
The IUPAC name of 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline (CID 24733452) is 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline.
What is the SMILES notation for 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline?
The canonical SMILES for 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline is COc1ccc(-c2cccc3ccc(N4CCN(c5ncccn5)CC4)nc23)c(OC)c1.
What is the InChIKey of 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline?
The InChIKey is KKBMFLRSLROKLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H25N5O2/c1-31-19-8-9-20(22(17-19)32-2)21-6-3-5-18-7-10-23(28-24(18)21)29-13-15-30(16-14-29)25-26-11-4-12-27-25/h3-12,17H,13-16H2,1-2H3.
What are the key properties of 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline?
8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline has a molecular weight of 427.51 g/mol, XLogP of 4.04, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(2,4-dimethoxyphenyl)-2-(4-pyrimidin-2-ylpiperazin-1-yl)quinoline is sourced from PubChem (CID 24733452), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).