C19H19N3OS — CID 24733547
1-[4-(8-thiophen-3-ylquinolin-2-yl)piperazin-1-yl]ethanone (PubChem CID 24733547) has the molecular formula C19H19N3OS and a molecular weight of 337.45 g/mol. Its IUPAC name is 1-[4-(8-thiophen-3-ylquinolin-2-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(8-thiophen-3-ylquinolin-2-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 24733547 |
| Molecular Formula | C19H19N3OS |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[4-(8-thiophen-3-ylquinolin-2-yl)piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc3cccc(-c4ccsc4)c3n2)CC1 |
| InChI | InChI=1S/C19H19N3OS/c1-14(23)21-8-10-22(11-9-21)18-6-5-15-3-2-4-17(19(15)20-18)16-7-12-24-13-16/h2-7,12-13H,8-11H2,1H3 |
| InChIKey | CPWSGFPHDHFWLM-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |