C23H22FN3O2 — CID 24733734
N-(3-fluorophenyl)-4-(3-pyridin-3-ylphenoxy)piperidine-1-carboxamide (PubChem CID 24733734) has the molecular formula C23H22FN3O2 and a molecular weight of 391.45 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-(3-pyridin-3-ylphenoxy)piperidine-1-carboxamide.
| Compound Name | N-(3-fluorophenyl)-4-(3-pyridin-3-ylphenoxy)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 24733734 |
| Molecular Formula | C23H22FN3O2 |
| Molecular Weight | 391.45 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | N-(3-fluorophenyl)-4-(3-pyridin-3-ylphenoxy)piperidine-1-carboxamide |
| SMILES | O=C(Nc1cccc(F)c1)N1CCC(Oc2cccc(-c3cccnc3)c2)CC1 |
| InChI | InChI=1S/C23H22FN3O2/c24-19-6-2-7-20(15-19)26-23(28)27-12-9-21(10-13-27)29-22-8-1-4-17(14-22)18-5-3-11-25-16-18/h1-8,11,14-16,21H,9-10,12-13H2,(H,26,28) |
| InChIKey | KUPYQSPRPQJUMX-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.45 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |