C22H23N3O5S — CID 24734129
2-(4-acetylphenyl)-7-[2-(benzenesulfonyl)ethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione (PubChem CID 24734129) has the molecular formula C22H23N3O5S and a molecular weight of 441.51 g/mol. Its IUPAC name is 2-(4-acetylphenyl)-7-[2-(benzenesulfonyl)ethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione.
| Compound Name | 2-(4-acetylphenyl)-7-[2-(benzenesulfonyl)ethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
|---|---|
| PubChem CID | 24734129 |
| Molecular Formula | C22H23N3O5S |
| Molecular Weight | 441.51 g/mol |
| Exact Mass | 441.14 |
| IUPAC Name | 2-(4-acetylphenyl)-7-[2-(benzenesulfonyl)ethyl]-5,6,8,8a-tetrahydroimidazo[1,5-a]pyrazine-1,3-dione |
| SMILES | CC(=O)c1ccc(N2C(=O)C3CN(CCS(=O)(=O)c4ccccc4)CCN3C2=O)cc1 |
| InChI | InChI=1S/C22H23N3O5S/c1-16(26)17-7-9-18(10-8-17)25-21(27)20-15-23(11-12-24(20)22(25)28)13-14-31(29,30)19-5-3-2-4-6-19/h2-10,20H,11-15H2,1H3 |
| InChIKey | LNZKGOJXUQTBJV-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 95.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.51 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|